Difference between revisions of "RXN-9222"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14392 CPD-14392] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
(Created page with "Category:Gene == Gene Ec-01_006350 == * left end position: ** 5488055 * transcription direction: ** POSITIVE * right end position: ** 5492226 * centisome position: ** 53.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14392 CPD-14392] ==
+
== Gene Ec-01_006350 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 5488055
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** stearidonoyl-CoA
+
** 5492226
−
* molecular weight:
+
* centisome position:
−
** 1021.905    
+
** 53.184837    
 
* Synonym(s):
 
* Synonym(s):
−
** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA
+
** Esi_0002_0321
 +
** Esi0002_0321
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[4.2.99.18-RXN]]
−
* [[RXN-16041]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-13426]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN0-2601]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5488055}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698349 70698349]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5492226}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71489 71489]
+
{{#set: centisome position=53.184837   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0002_0321|Esi0002_0321}}
−
{{#set: inchi key=InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J}}
+
{{#set: reaction associated=4.2.99.18-RXN|RXN0-2601}}
−
{{#set: common name=stearidonoyl-CoA}}
+
−
{{#set: molecular weight=1021.905   }}
+
−
{{#set: common name=(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA}}
+
−
{{#set: produced by=RXN-16041|RXN-13426}}
+

Revision as of 13:55, 21 March 2018

Gene Ec-01_006350

  • left end position:
    • 5488055
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5492226
  • centisome position:
    • 53.184837
  • Synonym(s):
    • Esi_0002_0321
    • Esi0002_0321

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9222&oldid=22753"