Difference between revisions of "Ec-13 002300"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14024 RXN-14024] == * direction: ** LEFT-TO-RIGHT * common name: ** Apyrase * ec number: ** [ht...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14024 RXN-14024] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
 +
* inchi key:
 +
** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
 
* common name:
 
* common name:
** Apyrase
+
** β-L-galactose 1-phosphate
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
+
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXNQT-4142]]
** 1 [[Nucleoside-Triphosphates]][c] '''+''' 2 [[WATER]][c] '''=>''' 2 [[Pi]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[Nucleoside-Monophosphates]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXNQT-4141]]
** 1 a nucleoside triphosphate[c] '''+''' 2 H2O[c] '''=>''' 2 phosphate[c] '''+''' 2 H+[c] '''+''' 1 a nucleoside 5'-monophosphate[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-02_001970]]
+
** ESILICULOSUS_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=Apyrase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461]
{{#set: ec number=EC-3.6.1.5}}
+
* CHEBI:
{{#set: gene associated=Ec-02_001970}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522]
{{#set: in pathway=}}
+
* LIGAND-CPD:
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926]
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}}
 +
{{#set: common name=β-L-galactose 1-phosphate}}
 +
{{#set: molecular weight=258.121    }}
 +
{{#set: consumed by=RXNQT-4142}}
 +
{{#set: produced by=RXNQT-4141}}

Revision as of 13:55, 21 March 2018

Metabolite CPDQT-4

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
  • inchi key:
    • InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
  • common name:
    • β-L-galactose 1-phosphate
  • molecular weight:
    • 258.121
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)" cannot be used as a page name in this wiki.