Difference between revisions of "TransportSeed CPD-3"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...") |
(Created page with "Category:Gene == Gene Ec-04_001110 == * left end position: ** 1273936 * transcription direction: ** NEGATIVE * right end position: ** 1281551 * centisome position: ** 19.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-04_001110 == |
− | * | + | * left end position: |
− | ** | + | ** 1273936 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1281551 |
− | * | + | * centisome position: |
− | ** | + | ** 19.563347 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0101_0047 |
+ | ** Esi0101_0047 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1273936}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1281551}} | |
− | + | {{#set: centisome position=19.563347 }} | |
− | + | {{#set: common name=Esi_0101_0047|Esi0101_0047}} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:56, 21 March 2018
Gene Ec-04_001110
- left end position:
- 1273936
- transcription direction:
- NEGATIVE
- right end position:
- 1281551
- centisome position:
- 19.563347
- Synonym(s):
- Esi_0101_0047
- Esi0101_0047
Reactions associated
- Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome