Difference between revisions of "Ec-16 002420"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-04_006380 == * left end position: ** 6359172 * transcription direction: ** NEGATIVE * right end position: ** 6369890 * centisome position: ** 97.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] == * smiles: ** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M |
− | * | + | * common name: |
− | ** | + | ** 7,8-dihydropteroate |
− | * | + | * molecular weight: |
− | ** | + | ** 313.295 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dihydropterate |
− | ** | + | ** H2Pte |
+ | ** dihydropteroate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DIHYDROFOLATESYNTH-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[H2PTEROATESYNTH-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459950 5459950] |
− | {{#set: | + | * HMDB : HMDB01412 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00921 C00921] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.4573669.html 4573669] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17839 17839] | ||
+ | * BIGG : 36380 | ||
+ | {{#set: smiles=C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))}} | ||
+ | {{#set: inchi key=InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=7,8-dihydropteroate}} | ||
+ | {{#set: molecular weight=313.295 }} | ||
+ | {{#set: common name=dihydropterate|H2Pte|dihydropteroate}} | ||
+ | {{#set: consumed by=DIHYDROFOLATESYNTH-RXN}} | ||
+ | {{#set: produced by=H2PTEROATESYNTH-RXN}} |
Revision as of 14:56, 21 March 2018
Contents
Metabolite 7-8-DIHYDROPTEROATE
- smiles:
- C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))
- inchi key:
- InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M
- common name:
- 7,8-dihydropteroate
- molecular weight:
- 313.295
- Synonym(s):
- dihydropterate
- H2Pte
- dihydropteroate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))" cannot be used as a page name in this wiki.