Difference between revisions of "1.14.19.3-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] == * smiles: ** C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1) * inchi key: ** InChIKey=QAI...") |
(Created page with "Category:Gene == Gene Ec-09_002930 == * left end position: ** 3363542 * transcription direction: ** POSITIVE * right end position: ** 3376925 * centisome position: ** 59.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_002930 == |
− | * | + | * left end position: |
− | ** | + | ** 3363542 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3376925 |
− | * | + | * centisome position: |
− | ** | + | ** 59.92242 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0021_0166 |
− | ** | + | ** Esi0021_0166 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[UDPNACETYLMURAMATEDEHYDROG-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | == | + | == Pathways associated == |
+ | * [[PWY-6386]] | ||
+ | * [[PWY-6387]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3363542}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3376925}} | |
− | + | {{#set: centisome position=59.92242 }} | |
− | + | {{#set: common name=Esi_0021_0166|Esi0021_0166}} | |
− | + | {{#set: reaction associated=UDPNACETYLMURAMATEDEHYDROG-RXN}} | |
− | + | {{#set: pathway associated=PWY-6386|PWY-6387}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:56, 21 March 2018
Gene Ec-09_002930
- left end position:
- 3363542
- transcription direction:
- POSITIVE
- right end position:
- 3376925
- centisome position:
- 59.92242
- Synonym(s):
- Esi_0021_0166
- Esi0021_0166
Reactions associated
- Reaction: UDPNACETYLMURAMATEDEHYDROG-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome