Difference between revisions of "2.4.1.101-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-02_005260 == * left end position: ** 5541497 * transcription direction: ** POSITIVE * right end position: ** 5543771 * centisome position: ** 84.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_005260 == |
− | * | + | * left end position: |
− | ** | + | ** 5541497 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5543771 |
− | * | + | * centisome position: |
− | ** | + | ** 84.89085 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0024_0152 |
+ | ** Esi0024_0152 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GLYOXIII-RXN]] | |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: automated-name-match | |
− | + | == Pathways associated == | |
− | * [[ | + | |
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5541497}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5543771}} | |
− | + | {{#set: centisome position=84.89085 }} | |
− | + | {{#set: common name=Esi_0024_0152|Esi0024_0152}} | |
− | + | {{#set: reaction associated=GLYOXIII-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:57, 21 March 2018
Gene Ec-02_005260
- left end position:
- 5541497
- transcription direction:
- POSITIVE
- right end position:
- 5543771
- centisome position:
- 84.89085
- Synonym(s):
- Esi_0024_0152
- Esi0024_0152
Reactions associated
- Reaction: GLYOXIII-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome