Difference between revisions of "Ec-16 002500"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-477 RXN66-477] == * direction: ** LEFT-TO-RIGHT * common name: ** straight chain fatty acyl-C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-477 RXN66-477] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J
 
* common name:
 
* common name:
−
** straight chain fatty acyl-CoA ligase
+
** dihomo γ-linolenoyl-CoA
−
** long chain acyl-coA synthetase
+
* molecular weight:
−
** long chain acyl-CoA synthetase
+
** 1051.975   
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** (8Z,11Z,14Z)-icosatrienoyl-CoA
 +
** (8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA
 +
** (8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-16044]]
−
** 1 [[Odd-Straight-Chain-234-Sat-FA]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[Odd-Saturated-Fatty-Acyl-CoA]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c]
+
* [[RXN-13435]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 an odd numbered straight chain 2,3,4-saturated fatty acid[c] '''+''' 1 coenzyme A[c] '''+''' 1 ATP[c] '''=>''' 1 an odd numbered straight chain 2,3,4-saturated fatty acyl CoA[c] '''+''' 1 AMP[c] '''+''' 1 diphosphate[c]
+
* [[RXN-17105]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-03_003710]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-02_006430]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-12_008720]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-01_001560]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY66-388]], fatty acid α-oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388]
+
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=straight chain fatty acyl-CoA ligase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581179 71581179]
−
{{#set: common name=long chain acyl-coA synthetase}}
+
* CHEBI:
−
{{#set: common name=long chain acyl-CoA synthetase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74264 74264]
−
{{#set: ec number=EC-6.2.1.3}}
+
{{#set: smiles=CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: gene associated=Ec-03_003710|Ec-02_006430|Ec-12_008720|Ec-01_001560}}
+
{{#set: inchi key=InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J}}
−
{{#set: in pathway=PWY66-388}}
+
{{#set: common name=dihomo γ-linolenoyl-CoA}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=1051.975    }}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=(8Z,11Z,14Z)-icosatrienoyl-CoA|(8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN-16044|RXN-13435}}
 +
{{#set: produced by=RXN-17105}}

Revision as of 13:57, 21 March 2018

Metabolite CPD-14407

  • smiles:
    • CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J
  • common name:
    • dihomo γ-linolenoyl-CoA
  • molecular weight:
    • 1051.975
  • Synonym(s):
    • (8Z,11Z,14Z)-icosatrienoyl-CoA
    • (8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA
    • (8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_002500&oldid=23051"