Difference between revisions of "Ec-01 007120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13990 RXN-13990] == * direction: ** REVERSIBLE * common name: ** L-4-hydroxy-2-oxoglutarate ald...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13990 RXN-13990] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
 +
* inchi key:
 +
** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
 
* common name:
 
* common name:
−
** L-4-hydroxy-2-oxoglutarate aldolase
+
** 5-hydroxyferulate
−
** KDPG/KHG aldolase
+
* molecular weight:
−
* ec number:
+
** 209.178   
−
** [http://enzyme.expasy.org/EC/4.1.3.42 EC-4.1.3.42]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxy ferulic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-3422]]
−
** 1 [[CPD-15016]][c] '''<=>''' 1 [[GLYOX]][c] '''+''' 1 [[PYRUVATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-1121]]
−
** 1 (4S)-4-hydroxy-2-oxoglutarate[c] '''<=>''' 1 glyoxylate[c] '''+''' 1 pyruvate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-27_004070]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=L-4-hydroxy-2-oxoglutarate aldolase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354]
−
{{#set: common name=KDPG/KHG aldolase}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-4.1.3.42}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619]
−
{{#set: gene associated=Ec-27_004070}}
+
* HMDB : HMDB35484
−
{{#set: in pathway=}}
+
{{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=5-hydroxyferulate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=209.178    }}
 +
{{#set: common name=5-hydroxy ferulic acid}}
 +
{{#set: consumed by=RXN-3422}}
 +
{{#set: produced by=RXN-1121}}

Revision as of 13:57, 21 March 2018

Metabolite 5-HYDROXY-FERULIC-ACID

  • smiles:
    • COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
  • inchi key:
    • InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
  • common name:
    • 5-hydroxyferulate
  • molecular weight:
    • 209.178
  • Synonym(s):
    • 5-hydroxy ferulic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_007120&oldid=23091"