Difference between revisions of "Ec-05 005460"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-UCP-E2-L-cysteine S-ubiquitinyl-UCP-E2-L-cysteine] == * common name: ** an S-ubiq...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THYROXINE L-THYROXINE] == * smiles: ** C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THYROXINE L-THYROXINE] == |
+ | * smiles: | ||
+ | ** C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=XUIIKFGFIJCVMT-LBPRGKRZSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-thyroxine |
+ | * molecular weight: | ||
+ | ** 776.874 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** levothyroxine |
+ | ** 3,3',5,5'-tetraiodo-L-thyronine | ||
+ | ** 3,5,3',5'-tetraiodo-L-thyronine | ||
+ | ** 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine | ||
+ | ** levothyroxin | ||
+ | ** O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine | ||
+ | ** T4 | ||
+ | ** L-T4 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-10614]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 51-48-9 |
− | {{#set: common name= | + | * DRUGBANK : DB00451 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201348 25201348] |
+ | * HMDB : HMDB00248 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01829 C01829] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5614.html 5614] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58448 58448] | ||
+ | * METABOLIGHTS : MTBLC18332 | ||
+ | {{#set: smiles=C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))}} | ||
+ | {{#set: inchi key=InChIKey=XUIIKFGFIJCVMT-LBPRGKRZSA-N}} | ||
+ | {{#set: common name=L-thyroxine}} | ||
+ | {{#set: molecular weight=776.874 }} | ||
+ | {{#set: common name=levothyroxine|3,3',5,5'-tetraiodo-L-thyronine|3,5,3',5'-tetraiodo-L-thyronine|4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine|levothyroxin|O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine|T4|L-T4}} | ||
+ | {{#set: consumed by=RXN-10614}} |
Revision as of 13:57, 21 March 2018
Contents
Metabolite L-THYROXINE
- smiles:
- C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))
- inchi key:
- InChIKey=XUIIKFGFIJCVMT-LBPRGKRZSA-N
- common name:
- L-thyroxine
- molecular weight:
- 776.874
- Synonym(s):
- levothyroxine
- 3,3',5,5'-tetraiodo-L-thyronine
- 3,5,3',5'-tetraiodo-L-thyronine
- 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine
- levothyroxin
- O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine
- T4
- L-T4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 51-48-9
- DRUGBANK : DB00451
- PUBCHEM:
- HMDB : HMDB00248
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18332
"C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))" cannot be used as a page name in this wiki.