Difference between revisions of "S-ubiquitinyl-UCP-E2-L-cysteine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KYNURENATE KYNURENATE] == * smiles: ** C1(C=C2(C(=CC=1)N=C(C(=O)[O-])C=C([O-])2)) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14140 RXN-14140] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14140 RXN-14140] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.6.1.19 EC-3.6.1.19] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[GTP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[GMP]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 GTP[c] '''=>''' 1 diphosphate[c] '''+''' 1 GMP[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-13_002810]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29394 29394] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.6.1.19}} | |
− | + | {{#set: gene associated=Ec-13_002810}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: reconstruction source=orthology-aragem}} |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:57, 21 March 2018
Contents
Reaction RXN-14140
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 1 GTP[c] => 1 diphosphate[c] + 1 GMP[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-13_002810
- Source: orthology-aragem
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links
- RHEA: