Difference between revisions of "Ec-26 004170"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOXYKIN-RXN PEPCARBOXYKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphoenol...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] == |
− | * | + | * smiles: |
− | ** | + | ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+] |
+ | * inchi key: | ||
+ | ** InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine |
− | * | + | * molecular weight: |
− | ** | + | ** 586.634 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP | ||
+ | ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-15681]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657130 90657130] |
− | + | {{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+]}} | |
− | + | {{#set: inchi key=InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N}} | |
− | + | {{#set: common name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}} | |
− | + | {{#set: molecular weight=586.634 }} | |
− | + | {{#set: common name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione}} | |
− | + | {{#set: produced by=RXN-15681}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 20:44, 17 March 2018
Contents
Metabolite CPD-17047
- smiles:
- C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+]
- inchi key:
- InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N
- common name:
- 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
- molecular weight:
- 586.634
- Synonym(s):
- 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+" cannot be used as a page name in this wiki.