Difference between revisions of "RXN-7919"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7396 PWY-7396] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7396 PWY-7396] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** butanol and isobutanol biosynthesis (engineered) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''8''' reactions in the full pathway |
| − | * [[ | + | * [[RXN-14986]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-16_002120]] |
| − | * [ | + | ** 1 reconstruction source(s) associated: |
| − | * [ | + | *** [[annotation-esiliculosus_genome]] |
| − | * [ | + | == Reaction(s) not found == |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=1.4.3.19-RXN 1.4.3.19-RXN] |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=3-ETHYLMALATE-SYNTHASE-RXN 3-ETHYLMALATE-SYNTHASE-RXN] |
| − | = | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14984 RXN-14984] |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14985 RXN-14985] |
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-161 RXN-161] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7643 RXN-7643] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7657 RXN-7657] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=butanol and isobutanol biosynthesis (engineered)}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=8}} | |
| − | + | {{#set: completion rate=13.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 20:44, 17 March 2018
Pathway PWY-7396
- taxonomic range:
- common name:
- butanol and isobutanol biosynthesis (engineered)
- Synonym(s):
Reaction(s) found
1 reactions found over 8 reactions in the full pathway
- RXN-14986
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
