Difference between revisions of "CPD-7005"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5462 RXN0-5462] == * direction: ** LEFT-TO-RIGHT * common name: ** nucleoside-triphosphatase *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5462 RXN0-5462] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** nucleoside-triphosphatase |
− | * | + | ** Tubulin/FtsZ, GTPase domain |
− | ** | + | ** GTPase HflX |
+ | ** Dynamin, GTPase domain | ||
+ | ** Apyrase | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/3.6.5.1 EC-3.6.5.1] | ||
+ | ** [http://enzyme.expasy.org/EC/3.6.5.2 EC-3.6.5.2] | ||
+ | ** [http://enzyme.expasy.org/EC/3.6.5.3 EC-3.6.5.3] | ||
+ | ** [http://enzyme.expasy.org/EC/3.6.5.4 EC-3.6.5.4] | ||
+ | ** [http://enzyme.expasy.org/EC/3.6.5.5 EC-3.6.5.5] | ||
+ | ** [http://enzyme.expasy.org/EC/3.6.5.6 EC-3.6.5.6] | ||
+ | ** [http://enzyme.expasy.org/EC/3.6.1.15 EC-3.6.1.15] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[GTP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[GDP]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 GTP[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 GDP[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-03_004860]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-02_005730]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-03_001180]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-05_005340]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-12_006200]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-06_005470]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-10_003360]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-01_004650]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-26_004830]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-01_003690]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-09_000120]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-01_008240]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-18_004660]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-28_000420]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-02_001970]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-17_000870]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-05_004560]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19669 19669] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00335 R00335] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=nucleoside-triphosphatase}} |
− | + | {{#set: common name=Tubulin/FtsZ, GTPase domain}} | |
− | + | {{#set: common name=GTPase HflX}} | |
− | + | {{#set: common name=Dynamin, GTPase domain}} | |
− | + | {{#set: common name=Apyrase}} | |
− | + | {{#set: ec number=EC-3.6.5.1}} | |
− | {{#set: | + | {{#set: ec number=EC-3.6.5.2}} |
− | {{#set: | + | {{#set: ec number=EC-3.6.5.3}} |
− | {{#set: | + | {{#set: ec number=EC-3.6.5.4}} |
− | {{#set: | + | {{#set: ec number=EC-3.6.5.5}} |
− | {{#set: | + | {{#set: ec number=EC-3.6.5.6}} |
− | {{#set: | + | {{#set: ec number=EC-3.6.1.15}} |
+ | {{#set: gene associated=Ec-03_004860|Ec-02_005730|Ec-03_001180|Ec-05_005340|Ec-12_006200|Ec-06_005470|Ec-10_003360|Ec-01_004650|Ec-26_004830|Ec-01_003690|Ec-09_000120|Ec-01_008240|Ec-18_004660|Ec-28_000420|Ec-02_001970|Ec-17_000870|Ec-05_004560}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 13:58, 21 March 2018
Contents
Reaction RXN0-5462
- direction:
- LEFT-TO-RIGHT
- common name:
- nucleoside-triphosphatase
- Tubulin/FtsZ, GTPase domain
- GTPase HflX
- Dynamin, GTPase domain
- Apyrase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 GTP[c] + 1 H2O[c] => 1 phosphate[c] + 1 GDP[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-03_004860
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-02_005730
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-03_001180
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-05_005340
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_006200
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_005470
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-10_003360
- Source: orthology-aragem
- Gene: Ec-01_004650
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-26_004830
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_003690
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-09_000120
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_008240
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-18_004660
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-28_000420
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-02_001970
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-17_000870
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-05_004560
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links