Difference between revisions of "Charged-MET-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH OH] == * smiles: ** [O-] * inchi key: ** InChIKey=XLYOFNOQVPJJNP-UHFFFAOYSA-M * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * smiles: ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == |
* smiles: | * smiles: | ||
| − | ** [O-] | + | ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M |
* common name: | * common name: | ||
| − | ** | + | ** (R)-S-lactoylglutathione |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 378.376 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** S-D-lactoylglutathione |
| − | ** | + | ** D-lactoylglutathione |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLYOXII-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[GLYOXI-RXN]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 25138-66-3 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878377 46878377] |
| − | * HMDB : | + | * HMDB : HMDB01066 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03451 C03451] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474] |
| − | {{#set: smiles=[O-]}} | + | * BIGG : 41876 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: common name=(R)-S-lactoylglutathione}} |
| − | {{#set: common name= | + | {{#set: molecular weight=378.376 }} |
| − | {{#set: | + | {{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}} |
| + | {{#set: consumed by=GLYOXII-RXN}} | ||
| + | {{#set: reversible reaction associated=GLYOXI-RXN}} | ||
Revision as of 13:58, 21 March 2018
Contents
Metabolite S-LACTOYL-GLUTATHIONE
- smiles:
- CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- inchi key:
- InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M
- common name:
- (R)-S-lactoylglutathione
- molecular weight:
- 378.376
- Synonym(s):
- S-D-lactoylglutathione
- D-lactoylglutathione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
