Difference between revisions of "Decanoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] == * smiles: ** CC(CO)=CCNC2(C1(=C(NC=N1)N=CN=2)) * inchi key: ** InChIKey=U...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitochondrial-Preproteins Mitochondrial-Preproteins] == * common name: ** a mitochondrial prepr...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitochondrial-Preproteins Mitochondrial-Preproteins] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a mitochondrial preprotein including a mitochondrial targeting sequence |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.4.24.64-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a mitochondrial preprotein including a mitochondrial targeting sequence}} | |
− | + | {{#set: consumed by=3.4.24.64-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 14:58, 21 March 2018
Contents
Metabolite Mitochondrial-Preproteins
- common name:
- a mitochondrial preprotein including a mitochondrial targeting sequence
- Synonym(s):