Difference between revisions of "CPD-591"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1581 PWY-1581] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-28...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1581 PWY-1581] ==
* smiles:
+
* taxonomic range:
** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-2870]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
** cyanidin
+
** plastoquinol-9 biosynthesis I
* molecular weight:
+
** 285.232   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
+
** plastoquinone biosynthesis I
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
+
** plastoquinone-9 biosynthesis I
** 3,3',4',5,7-pentahydroxyflavylium
+
** plastoquinol biosynthesis I
** cyanidol
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-9725]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
* [[RXN-602]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-23_003630]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2761 RXN-2761]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2762 RXN-2762]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-1581 PWY-1581]
* CHEBI:
+
{{#set: taxonomic range=TAX-2870}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682]
+
{{#set: taxonomic range=TAX-2763}}
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-33090}}
** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905]
+
{{#set: common name=plastoquinol-9 biosynthesis I}}
* HMDB : HMDB02708
+
{{#set: common name=plastoquinone biosynthesis I|plastoquinone-9 biosynthesis I|plastoquinol biosynthesis I}}
{{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}}
+
{{#set: total reaction=3}}
{{#set: common name=cyanidin}}
+
{{#set: completion rate=33.0}}
{{#set: molecular weight=285.232    }}
+
{{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}}
+
{{#set: consumed by=RXN-9725}}
+
{{#set: produced by=RXN-602}}
+

Revision as of 20:45, 17 March 2018

Pathway PWY-1581

  • taxonomic range:
  • common name:
    • plastoquinol-9 biosynthesis I
  • Synonym(s):
    • plastoquinone biosynthesis I
    • plastoquinone-9 biosynthesis I
    • plastoquinol biosynthesis I

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links