Difference between revisions of "PWY-5913"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1118 TAX-11...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1118 TAX-1118]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1217 TAX-1217]
−
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* common name:
 
* common name:
−
** 3-oxo-(7Z)-tetradecenoyl-CoA
+
** partial TCA cycle (obligate autotrophs)
−
* molecular weight:
+
−
** 985.829   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-14:1-Δ7-CoA
+
** TCA cycle VI (obligate autotrophs)
−
** 3-oxo-7-cis-tetradecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''10''' reactions found over '''11''' reactions in the full pathway
−
* [[RXN-17794]]
+
* [[ACONITATEDEHYDR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-03_003270]]
 +
*** [[Ec-01_007480]]
 +
*** [[Ec-23_003500]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[CITSYN-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-25_001360]]
 +
*** [[Ec-23_003460]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GLUTDEHYD-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-06_008240]]
 +
*** [[Ec-12_008040]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ISOCITDEH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_003080]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_006200]]
 +
*** [[Ec-02_003100]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PEPCARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-28_003470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_000030]]
 +
*** [[Ec-02_001020]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14970 RXN-14970]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-1118}}
−
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
+
{{#set: taxonomic range=TAX-1217}}
−
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-1224}}
−
{{#set: molecular weight=985.829    }}
+
{{#set: common name=partial TCA cycle (obligate autotrophs)}}
−
{{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
+
{{#set: common name=TCA cycle VI (obligate autotrophs)}}
−
{{#set: produced by=RXN-17794}}
+
{{#set: reaction found=10}}
 +
{{#set: total reaction=11}}
 +
{{#set: completion rate=91.0}}

Latest revision as of 19:00, 21 March 2018

Pathway PWY-5913

  • taxonomic range:
  • common name:
    • partial TCA cycle (obligate autotrophs)
  • Synonym(s):
    • TCA cycle VI (obligate autotrophs)

Reaction(s) found

10 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5913&oldid=23763"