Difference between revisions of "5-HYDROXYINDOLE ACETATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R222-RXN R222-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-octanal dehydrogenase (NAD+...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R222-RXN R222-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J
 
* common name:
 
* common name:
** 1-octanal dehydrogenase (NAD+)
+
** 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
+
** 927.663   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-11245]]
** 1 [[NAD]][c] '''+''' 1 [[CPD-371]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-195]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-11244]]
** 1 NAD+[c] '''+''' 1 1-octanal[c] '''+''' 1 H2O[c] '''=>''' 1 octanoate[c] '''+''' 2 H+[c] '''+''' 1 NADH[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[P221-PWY]], octane oxidation: [http://metacyc.org/META/NEW-IMAGE?object=P221-PWY P221-PWY]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=1-octanal dehydrogenase (NAD+)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173446 46173446]
{{#set: ec number=EC-1.2.1.3}}
+
* CHEBI:
{{#set: in pathway=P221-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73549 73549]
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J}}
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA}}
 +
{{#set: molecular weight=927.663    }}
 +
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA}}
 +
{{#set: consumed by=RXN-11245}}
 +
{{#set: produced by=RXN-11244}}

Revision as of 20:45, 17 March 2018

Metabolite CPD-12199

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
  • inchi key:
    • InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J
  • common name:
    • 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA
  • molecular weight:
    • 927.663
  • Synonym(s):
    • 3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.