Difference between revisions of "DNA-LIGASE-ATP-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] == * smiles: ** C(CC1(C2(=C(NC=1)C=CC=C2)))=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-LIGASE-ATP-RXN DNA-LIGASE-ATP-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** DNA ligas...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-LIGASE-ATP-RXN DNA-LIGASE-ATP-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** DNA ligase (ATP) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.5.1.7 EC-6.5.1.7] |
+ | ** [http://enzyme.expasy.org/EC/6.5.1.1 EC-6.5.1.1] | ||
+ | ** [http://enzyme.expasy.org/EC/6.5.1.6 EC-6.5.1.6] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[DNA-N]][c] '''+''' 1 [[DEOXYNUCLEOTIDESM]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[DEOXYNUCLEOTIDESM]][c] '''+''' 1 [[AMP]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 DNAn[c] '''+''' 1 (deoxynucleotides)(m)[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 (deoxynucleotides)(m)[c] '''+''' 1 AMP[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-01_011680]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-07_005930]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00381 R00381] |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P12000 P12000] |
− | * | + | ** [http://www.uniprot.org/uniprot/P18858 P18858] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P35970 P35970] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9QNG8 Q9QNG8] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PM08 Q9PM08] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q57635 Q57635] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P49917 P49917] |
− | * | + | ** [http://www.uniprot.org/uniprot/P49916 P49916] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P37913 P37913] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P51892 P51892] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P16272 P16272] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P33798 P33798] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00970 P00970] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00969 P00969] |
+ | ** [http://www.uniprot.org/uniprot/P04819 P04819] | ||
+ | ** [http://www.uniprot.org/uniprot/P19088 P19088] | ||
+ | ** [http://www.uniprot.org/uniprot/P07717 P07717] | ||
+ | ** [http://www.uniprot.org/uniprot/P26813 P26813] | ||
+ | ** [http://www.uniprot.org/uniprot/Q02093 Q02093] | ||
+ | ** [http://www.uniprot.org/uniprot/Q23694 Q23694] | ||
+ | ** [http://www.uniprot.org/uniprot/Q67480 Q67480] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42572 Q42572] | ||
+ | ** [http://www.uniprot.org/uniprot/P20492 P20492] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=DNA ligase (ATP)}} | ||
+ | {{#set: ec number=EC-6.5.1.7}} | ||
+ | {{#set: ec number=EC-6.5.1.1}} | ||
+ | {{#set: ec number=EC-6.5.1.6}} | ||
+ | {{#set: gene associated=Ec-01_011680|Ec-07_005930}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:00, 21 March 2018
Contents
Reaction DNA-LIGASE-ATP-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- DNA ligase (ATP)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DNA-N[c] + 1 DEOXYNUCLEOTIDESM[c] + 1 ATP[c] => 1 PPI[c] + 1 DEOXYNUCLEOTIDESM[c] + 1 AMP[c]
- With common name(s):
- 1 DNAn[c] + 1 (deoxynucleotides)(m)[c] + 1 ATP[c] => 1 diphosphate[c] + 1 (deoxynucleotides)(m)[c] + 1 AMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-01_011680
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-07_005930
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN:
- UNIPROT: