Difference between revisions of "PWY-7589"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-BUTYRATE 4-AMINO-BUTYRATE] == * smiles: ** C(C[N+])CC([O-])=O * inchi key: ** InChIKey=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7589 PWY-7589] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-BUTYRATE 4-AMINO-BUTYRATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7589 PWY-7589] ==
−
* smiles:
+
* taxonomic range:
−
** C(C[N+])CC([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
−
** InChIKey=BTCSSZJGUNDROE-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 4-aminobutanoate
+
** palmitoleate biosynthesis III (cyanobacteria)
−
* molecular weight:
+
−
** 103.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-NH2-but
+
** palmitoleic acid biosynthesis III (cyanobacteria)
−
** 4-NH3-but
+
−
** GABA
+
−
** 4-aminobutyric acid
+
−
** γ-aminobutyrate
+
−
** 4-amino-n-butyric acid
+
−
** γ-amino-n-butyric acid
+
−
** gamma-amino-N-butyrate
+
−
** g-amino-n-butyric acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[biomass_rxn]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-16032]]
−
* [[GUANIDINOBUTYRASE-RXN]]
+
** 4 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-12_004670]]
−
* [[RXN-14209]]
+
*** [[Ec-02_006160]]
 +
*** [[Ec-21_003240]]
 +
*** [[Ec-26_001280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16035 RXN-16035]
 
== External links  ==
 
== External links  ==
−
* CAS : 56-12-2
+
{{#set: taxonomic range=TAX-33090}}
−
* BIGG : 34652
+
{{#set: taxonomic range=TAX-1117}}
−
* PUBCHEM:
+
{{#set: common name=palmitoleate biosynthesis III (cyanobacteria)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992099 6992099]
+
{{#set: common name=palmitoleic acid biosynthesis III (cyanobacteria)}}
−
* HMDB : HMDB00112
+
{{#set: reaction found=1}}
−
* LIGAND-CPD:
+
{{#set: total reaction=2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00334 C00334]
+
{{#set: completion rate=50.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59888 59888]
+
−
* METABOLIGHTS : MTBLC59888
+
−
{{#set: smiles=C(C[N+])CC([O-])=O}}
+
−
{{#set: inchi key=InChIKey=BTCSSZJGUNDROE-UHFFFAOYSA-N}}
+
−
{{#set: common name=4-aminobutanoate}}
+
−
{{#set: molecular weight=103.121    }}
+
−
{{#set: common name=4-NH2-but|4-NH3-but|GABA|4-aminobutyric acid|γ-aminobutyrate|4-amino-n-butyric acid|γ-amino-n-butyric acid|gamma-amino-N-butyrate|g-amino-n-butyric acid}}
+
−
{{#set: consumed by=biomass_rxn}}
+
−
{{#set: produced by=GUANIDINOBUTYRASE-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14209}}
+

Latest revision as of 19:01, 21 March 2018

Pathway PWY-7589

  • taxonomic range:
  • common name:
    • palmitoleate biosynthesis III (cyanobacteria)
  • Synonym(s):
    • palmitoleic acid biosynthesis III (cyanobacteria)

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7589&oldid=23845"