Difference between revisions of "MYRICETIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENIC_ACID LINOLENIC_ACID] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)[O-] * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAZOLSYN3-RXN THIAZOLSYN3-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-methyl-5(b-hy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAZOLSYN3-RXN THIAZOLSYN3-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4-methyl-5(b-hydroxyethyl)-thiazole monophosphate biosynthesis protein, putative |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.50 EC-2.7.1.50] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[THZ]][c] '''=>''' 1 [[THZ-P]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 ATP[c] '''+''' 1 5-(2-hydroxyethyl)-4-methylthiazole[c] '''=>''' 1 4-methyl-5-(2-phosphooxyethyl)thiazole[c] '''+''' 1 H+[c] '''+''' 1 ADP[c] |
− | * [[ | + | |
− | + | == Genes associated with this reaction == | |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * [[Ec-01_008860]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6897]], thiamine salvage II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-7356]], thiamine salvage IV (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] | ||
+ | ** '''4''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-7357]], thiamine formation from pyrithiamine and oxythiamine (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7357 PWY-7357] | ||
+ | ** '''3''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24212 24212] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04448 R04448] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P41835 P41835] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/O28204 O28204] |
− | * | + | ** [http://www.uniprot.org/uniprot/P76423 P76423] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q57233 Q57233] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CG46 Q9CG46] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P39593 P39593] |
− | * | + | ** [http://www.uniprot.org/uniprot/P40386 P40386] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=4-methyl-5(b-hydroxyethyl)-thiazole monophosphate biosynthesis protein, putative}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.1.50}} |
− | {{#set: | + | {{#set: gene associated=Ec-01_008860}} |
− | {{#set: | + | {{#set: in pathway=PWY-6897|PWY-7356|PWY-7357}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 20:45, 17 March 2018
Contents
Reaction THIAZOLSYN3-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 4-methyl-5(b-hydroxyethyl)-thiazole monophosphate biosynthesis protein, putative
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] + 1 5-(2-hydroxyethyl)-4-methylthiazole[c] => 1 4-methyl-5-(2-phosphooxyethyl)thiazole[c] + 1 H+[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-01_008860
- ESILICULOSUS_GENOME
- AUTOMATED-NAME-MATCH
- ESILICULOSUS_GENOME
Pathways
- PWY-6897, thiamine salvage II: PWY-6897
- 3 reactions found over 5 reactions in the full pathway
- PWY-7356, thiamine salvage IV (yeast): PWY-7356
- 4 reactions found over 7 reactions in the full pathway
- PWY-7357, thiamine formation from pyrithiamine and oxythiamine (yeast): PWY-7357
- 3 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links