Difference between revisions of "CPD-4581"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-LIGASE-ATP-RXN DNA-LIGASE-ATP-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** DNA ligas...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-LIGASE-ATP-RXN DNA-LIGASE-ATP-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
 
* common name:
 
* common name:
** DNA ligase (ATP)
+
** 5α-cholesta-8,24-dien-3-one
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/6.5.1.7 EC-6.5.1.7]
+
** 382.628   
** [http://enzyme.expasy.org/EC/6.5.1.1 EC-6.5.1.1]
+
** [http://enzyme.expasy.org/EC/6.5.1.6 EC-6.5.1.6]
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[DNA-N]][c] '''+''' 1 [[DEOXYNUCLEOTIDESM]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[DEOXYNUCLEOTIDESM]][c] '''+''' 1 [[AMP]][c]
+
* [[RXN66-318]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 DNAn[c] '''+''' 1 (deoxynucleotides)(m)[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 (deoxynucleotides)(m)[c] '''+''' 1 AMP[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Ec-01_011680]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: GO-TERM
+
* Gene: [[Ec-07_005930]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: GO-TERM
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R00381 R00381]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942]
* UNIPROT:
+
* CHEBI:
** [http://www.uniprot.org/uniprot/P12000 P12000]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386]
** [http://www.uniprot.org/uniprot/P18858 P18858]
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}}
** [http://www.uniprot.org/uniprot/P35970 P35970]
+
{{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}}
** [http://www.uniprot.org/uniprot/Q9QNG8 Q9QNG8]
+
{{#set: common name=5α-cholesta-8,24-dien-3-one}}
** [http://www.uniprot.org/uniprot/Q9PM08 Q9PM08]
+
{{#set: molecular weight=382.628    }}
** [http://www.uniprot.org/uniprot/Q57635 Q57635]
+
{{#set: produced by=RXN66-318}}
** [http://www.uniprot.org/uniprot/P49917 P49917]
+
** [http://www.uniprot.org/uniprot/P49916 P49916]
+
** [http://www.uniprot.org/uniprot/P37913 P37913]
+
** [http://www.uniprot.org/uniprot/P51892 P51892]
+
** [http://www.uniprot.org/uniprot/P16272 P16272]
+
** [http://www.uniprot.org/uniprot/P33798 P33798]
+
** [http://www.uniprot.org/uniprot/P00970 P00970]
+
** [http://www.uniprot.org/uniprot/P00969 P00969]
+
** [http://www.uniprot.org/uniprot/P04819 P04819]
+
** [http://www.uniprot.org/uniprot/P19088 P19088]
+
** [http://www.uniprot.org/uniprot/P07717 P07717]
+
** [http://www.uniprot.org/uniprot/P26813 P26813]
+
** [http://www.uniprot.org/uniprot/Q02093 Q02093]
+
** [http://www.uniprot.org/uniprot/Q23694 Q23694]
+
** [http://www.uniprot.org/uniprot/Q67480 Q67480]
+
** [http://www.uniprot.org/uniprot/Q42572 Q42572]
+
** [http://www.uniprot.org/uniprot/P20492 P20492]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=DNA ligase (ATP)}}
+
{{#set: ec number=EC-6.5.1.7}}
+
{{#set: ec number=EC-6.5.1.1}}
+
{{#set: ec number=EC-6.5.1.6}}
+
{{#set: gene associated=Ec-01_011680|Ec-07_005930}}
+
{{#set: in pathway=}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:01, 21 March 2018

Metabolite CPD-4581

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
  • common name:
    • 5α-cholesta-8,24-dien-3-one
  • molecular weight:
    • 382.628
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.