Difference between revisions of "RXN-16065"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMIDINE SPERMIDINE] == * smiles: ** C([N+])CC[N+]CCCC[N+] * inchi key: ** InChIKey=ATHGHQPFG...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16065 RXN-16065] == * direction: ** LEFT-TO-RIGHT * common name: ** Cytochrome b5-like heme/ste...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMIDINE SPERMIDINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16065 RXN-16065] ==
* smiles:
+
* direction:
** C([N+])CC[N+]CCCC[N+]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ATHGHQPFGPMSJY-UHFFFAOYSA-Q
+
 
* common name:
 
* common name:
** spermidine
+
** Cytochrome b5-like heme/steroid binding domain
* molecular weight:
+
* ec number:
** 148.271   
+
** [http://enzyme.expasy.org/EC/1.14.19.3 EC-1.14.19.3]
 
* Synonym(s):
 
* Synonym(s):
** N-(3-aminopropyl)butane-1,4-diamine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[SPERMINE-SYNTHASE-RXN]]
+
* With identifiers:
* [[RXN-13414]]
+
** 2 [[FERROCYTOCHROME-B5]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PALMITYL-COA]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[CPD-17313]][c] '''+''' 2 [[WATER]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 2 a ferrocytochrome b5[c] '''+''' 2 H+[c] '''+''' 1 oxygen[c] '''+''' 1 palmitoyl-CoA[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 1 sapienoyl-CoA[c] '''+''' 2 H2O[c]
* [[SPERMIDINESYN-RXN]]
+
 
* [[2.5.1.46-RXN]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-24_002300]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 124-20-9
+
{{#set: direction=LEFT-TO-RIGHT}}
* BIGG : 34593
+
{{#set: common name=Cytochrome b5-like heme/steroid binding domain}}
* PUBCHEM:
+
{{#set: ec number=EC-1.14.19.3}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992097 6992097]
+
{{#set: gene associated=Ec-24_002300}}
* HMDB : HMDB01257
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C00315 C00315]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.chemspider.com/Chemical-Structure.5360248.html 5360248]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57834 57834]
+
* METABOLIGHTS : MTBLC57834
+
{{#set: smiles=C([N+])CC[N+]CCCC[N+]}}
+
{{#set: inchi key=InChIKey=ATHGHQPFGPMSJY-UHFFFAOYSA-Q}}
+
{{#set: common name=spermidine}}
+
{{#set: molecular weight=148.271    }}
+
{{#set: common name=N-(3-aminopropyl)butane-1,4-diamine}}
+
{{#set: consumed by=SPERMINE-SYNTHASE-RXN|RXN-13414}}
+
{{#set: reversible reaction associated=SPERMIDINESYN-RXN|2.5.1.46-RXN}}
+

Latest revision as of 19:02, 21 March 2018

Reaction RXN-16065

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Cytochrome b5-like heme/steroid binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links