Difference between revisions of "Ec-08 000930"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * inchi key: ** InChIKey=I...")
(Created page with "Category:Gene == Gene Ec-08_000930 == * left end position: ** 945965 * transcription direction: ** POSITIVE * right end position: ** 954854 * centisome position: ** 14.125...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] ==
+
== Gene Ec-08_000930 ==
−
* smiles:
+
* left end position:
−
** C(C1(OC(C(C(C=1)O)O)O))([O-])=O
+
** 945965
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-deoxy-L-threo-hex-4-enopyranuronate
+
** 954854
−
* molecular weight:
+
* centisome position:
−
** 175.118    
+
** 14.125066    
 
* Synonym(s):
 
* Synonym(s):
−
** (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
+
** Esi_0214_0043
−
** 4-deoxy-L-threo-5-hexosulose-uronic acid
+
** Esi0214_0043
−
** 4-deoxy-L-threo-5-hexosulose-uronate
+
−
** 4-deoxy-L-threo-hex-4-enopyranuronate
+
−
** 4-deoxy-β-L-threo-hex-4-enopyranuronose
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[4.2.2.10-RXN]]
−
* [[RXN-12178]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-12270]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-14897]]
−
* [[RXN-16475]]
+
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7243]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=945965}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819971 91819971]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=954854}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62482 62482]
+
{{#set: centisome position=14.125066   }}
−
{{#set: smiles=C(C1(OC(C(C(C=1)O)O)O))([O-])=O}}
+
{{#set: common name=Esi_0214_0043|Esi0214_0043}}
−
{{#set: inchi key=InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M}}
+
{{#set: reaction associated=4.2.2.10-RXN|RXN-14897}}
−
{{#set: common name=4-deoxy-L-threo-hex-4-enopyranuronate}}
+
{{#set: pathway associated=PWY-7243}}
−
{{#set: molecular weight=175.118   }}
+
−
{{#set: common name=(3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid|4-deoxy-L-threo-5-hexosulose-uronic acid|4-deoxy-L-threo-5-hexosulose-uronate|4-deoxy-L-threo-hex-4-enopyranuronate|4-deoxy-β-L-threo-hex-4-enopyranuronose}}
+
−
{{#set: produced by=RXN-12178|RXN-12270}}
+
−
{{#set: reversible reaction associated=RXN-16475}}
+

Latest revision as of 19:02, 21 March 2018

Gene Ec-08_000930

  • left end position:
    • 945965
  • transcription direction:
    • POSITIVE
  • right end position:
    • 954854
  • centisome position:
    • 14.125066
  • Synonym(s):
    • Esi_0214_0043
    • Esi0214_0043

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_000930&oldid=24066"