Difference between revisions of "Ec-19 002210"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-19_002210 == * left end position: ** 2407285 * transcription direction: ** POSITIVE * right end position: ** 2411840 * centisome position: ** 40.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_002210 == |
− | * | + | * left end position: |
− | ** | + | ** 2407285 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2411840 |
− | * | + | * centisome position: |
− | ** | + | ** 40.318386 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0425_0023 |
− | ** | + | ** Esi0425_0023 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[HEMN-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
+ | * [[PWY-5531]] | ||
+ | * [[HEMESYN2-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2407285}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2411840}} | |
− | + | {{#set: centisome position=40.318386 }} | |
− | + | {{#set: common name=Esi_0425_0023|Esi0425_0023}} | |
− | + | {{#set: reaction associated=HEMN-RXN}} | |
− | + | {{#set: pathway associated=PWY-5531|HEMESYN2-PWY}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:02, 21 March 2018
Gene Ec-19_002210
- left end position:
- 2407285
- transcription direction:
- POSITIVE
- right end position:
- 2411840
- centisome position:
- 40.318386
- Synonym(s):
- Esi_0425_0023
- Esi0425_0023
Reactions associated
- Reaction: HEMN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome