Difference between revisions of "Unwound-DNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] == * smiles: ** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) * common name: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-DNA Unwound-DNA] == * common name: ** an unwound double-stranded DNA * Synonym(s): ==...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-DNA Unwound-DNA] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an unwound double-stranded DNA |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-11135]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an unwound double-stranded DNA}} | |
| − | + | {{#set: reversible reaction associated=RXN-11135}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:02, 21 March 2018
Contents
Metabolite Unwound-DNA
- common name:
- an unwound double-stranded DNA
- Synonym(s):
