Difference between revisions of "ExchangeSeed K+"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * smiles: ** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N4-N-ACETYL-BETA-D-GLUCOSAMINYL-X N4-N-ACETYL-BETA-D-GLUCOSAMINYL-X] == * common name: ** an N4...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N4-N-ACETYL-BETA-D-GLUCOSAMINYL-X N4-N-ACETYL-BETA-D-GLUCOSAMINYL-X] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-[β-D-xylosyl-(1,2)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-L-asparagine-[protein] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** GnGnX-glycopeptide | ||
+ | ** GnGnX-GP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[2.4.2.38-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=an N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-[β-D-xylosyl-(1,2)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-L-asparagine-[protein]}} | |
− | + | {{#set: common name=GnGnX-glycopeptide|GnGnX-GP}} | |
− | + | {{#set: reversible reaction associated=2.4.2.38-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 21:24, 17 March 2018
Contents
Metabolite N4-N-ACETYL-BETA-D-GLUCOSAMINYL-X
- common name:
- an N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-[β-D-xylosyl-(1,2)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-L-asparagine-[protein]
- Synonym(s):
- GnGnX-glycopeptide
- GnGnX-GP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-[β-D-xylosyl-(1,2)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-L-asparagine-[protein" cannot be used as a page name in this wiki.