Difference between revisions of "CPD-12673"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5366 PWY-5366] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * smiles: ** C(=O)([O-])C(O)C(O)C(O)CCl * inchi key: ** InChIKey=IJQSOC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(=O)([O-])C(O)C(O)C(O)CCl |
| − | ** | + | * inchi key: |
| + | ** InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 5-chloro-5-deoxy-D-ribonate |
| + | * molecular weight: | ||
| + | ** 183.568 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-11717]] | |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859707 49859707] | |
| − | {{#set: | + | {{#set: smiles=C(=O)([O-])C(O)C(O)C(O)CCl}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M}} |
| − | {{#set: | + | {{#set: common name=5-chloro-5-deoxy-D-ribonate}} |
| − | {{#set: | + | {{#set: molecular weight=183.568 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-11717}} |
Latest revision as of 19:03, 21 March 2018
Contents
Metabolite CPD-12673
- smiles:
- C(=O)([O-])C(O)C(O)C(O)CCl
- inchi key:
- InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
- common name:
- 5-chloro-5-deoxy-D-ribonate
- molecular weight:
- 183.568
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C(O)C(O)C(O)CCl" cannot be used as a page name in this wiki.
