Difference between revisions of "PWY-5940"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7648 RXN-7648] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N |
+ | * common name: | ||
+ | ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone | ||
+ | * molecular weight: | ||
+ | ** 697.095 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14177]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-CPD: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05814 C05814] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28636 28636] | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280836 5280836] |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N}} |
− | {{#set: | + | {{#set: common name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}} |
+ | {{#set: molecular weight=697.095 }} | ||
+ | {{#set: produced by=RXN-14177}} |
Revision as of 20:46, 17 March 2018
Contents
Metabolite CPD-15153
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)
- inchi key:
- InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N
- common name:
- 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
- molecular weight:
- 697.095
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links