Difference between revisions of "GLUTSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-26_002430 == * left end position: ** 2752576 * transcription direction: ** NEGATIVE * right end position: ** 2757827 * centisome position: ** 41.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_002430 == |
− | * | + | * left end position: |
− | ** | + | ** 2752576 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2757827 |
− | * | + | * centisome position: |
− | ** | + | ** 41.811188 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0212_0023 |
− | ** | + | ** Esi0212_0023 |
− | == | + | == Reactions associated == |
− | == | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] |
− | * [[ | + | ** esiliculosus_genome |
− | + | ***ec-number | |
+ | == Pathways associated == | ||
+ | * [[PWY-7765]] | ||
+ | * [[PWY-5651]] | ||
+ | * [[PWY-6309]] | ||
+ | * [[PWY-7717]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2752576}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=2757827}} |
− | {{#set: | + | {{#set: centisome position=41.811188 }} |
− | {{#set: | + | {{#set: common name=Esi_0212_0023|Esi0212_0023}} |
− | {{#set: | + | {{#set: reaction associated=KYNURENINE-3-MONOOXYGENASE-RXN}} |
− | {{#set: common name= | + | {{#set: pathway associated=PWY-7765|PWY-5651|PWY-6309|PWY-7717}} |
− | {{#set: | + |
Revision as of 21:46, 17 March 2018
Gene Ec-26_002430
- left end position:
- 2752576
- transcription direction:
- NEGATIVE
- right end position:
- 2757827
- centisome position:
- 41.811188
- Synonym(s):
- Esi_0212_0023
- Esi0212_0023
Reactions associated
- KYNURENINE-3-MONOOXYGENASE-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome