Difference between revisions of "PWY-5994"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** palmitate biosynthesis I (animals and fungi) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** palmitic acid biosynthesis |
− | ** | + | ** de novo lipogenesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''20''' reactions found over '''31''' reactions in the full pathway | |
− | * [[ | + | * [[4.2.1.58-RXN]] |
− | * [[RXN- | + | ** 0 associated gene: |
− | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-esiliculosus_genome]] |
+ | * [[4.2.1.61-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-9514]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9515]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9518]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9524]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9528]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9532]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9533]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-9536]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9537]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-9540]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9549]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-9648]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-12_000650]] | ||
+ | *** [[Ec-27_003480]] | ||
+ | *** [[Ec-27_002090]] | ||
+ | *** [[Ec-12_000640]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9650]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-12_000650]] | ||
+ | *** [[Ec-12_000640]] | ||
+ | *** [[Ec-27_002090]] | ||
+ | *** [[Ec-27_003480]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9651]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-27_002090]] | ||
+ | *** [[Ec-12_000650]] | ||
+ | *** [[Ec-12_000640]] | ||
+ | *** [[Ec-27_003480]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9652]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-27_003480]] | ||
+ | *** [[Ec-12_000650]] | ||
+ | *** [[Ec-27_002090]] | ||
+ | *** [[Ec-12_000640]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9653]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-27_003480]] | ||
+ | *** [[Ec-27_002090]] | ||
+ | *** [[Ec-12_000640]] | ||
+ | *** [[Ec-12_000650]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9654]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-12_000650]] | ||
+ | *** [[Ec-27_003480]] | ||
+ | *** [[Ec-27_002090]] | ||
+ | *** [[Ec-12_000640]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9655]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.21-RXN 3.1.2.21-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.59-RXN 4.2.1.59-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PALMITOYL-COA-HYDROLASE-RXN PALMITOYL-COA-HYDROLASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9520 RXN-9520] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9521 RXN-9521] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9526 RXN-9526] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9530 RXN-9530] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9534 RXN-9534] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9538 RXN-9538] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9542 RXN-9542] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-9780 RXN3O-9780] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33154}} | |
− | + | {{#set: common name=palmitate biosynthesis I (animals and fungi)}} | |
− | + | {{#set: common name=palmitic acid biosynthesis|de novo lipogenesis}} | |
− | + | {{#set: reaction found=20}} | |
− | + | {{#set: total reaction=31}} | |
− | + | {{#set: completion rate=65.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:04, 21 March 2018
Pathway PWY-5994
- taxonomic range:
- common name:
- palmitate biosynthesis I (animals and fungi)
- Synonym(s):
- palmitic acid biosynthesis
- de novo lipogenesis
Reaction(s) found
20 reactions found over 31 reactions in the full pathway
- 4.2.1.58-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- 4.2.1.61-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-9514
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9515
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-9518
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9524
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9528
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9532
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9533
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-9536
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9537
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-9540
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9549
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-9648
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9650
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9651
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9652
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9653
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9654
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9655
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
- 3.1.2.21-RXN
- 4.2.1.59-RXN
- PALMITOYL-COA-HYDROLASE-RXN
- RXN-9520
- RXN-9521
- RXN-9526
- RXN-9530
- RXN-9534
- RXN-9538
- RXN-9542
- RXN3O-9780