Difference between revisions of "PWY-6433"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(OP([O-])(=O)OP([O-])(=O)[O-])C(O)C(O)1) * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** hydroxylated fatty acid biosynthesis (plants) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''7''' reactions found over '''22''' reactions in the full pathway |
− | * [[ | + | * [[RXN-13322]] |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Ec-28_003080]] |
− | + | ** 1 reconstruction source(s) associated: | |
− | + | *** [[annotation-esiliculosus_genome]] | |
− | * [[ | + | * [[RXN-16150]] |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Ec-16_002160]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * [[RXN- | + | *** [[annotation-esiliculosus_genome]] |
− | * [[ | + | * [[RXN-16151]] |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Ec-16_002160]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-16152]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-16_002160]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-16157]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-16_002160]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-16158]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-16_002160]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9670]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-16_002160]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14484 RXN-14484] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14485 RXN-14485] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14486 RXN-14486] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14488 RXN-14488] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14491 RXN-14491] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14492 RXN-14492] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14493 RXN-14493] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14494 RXN-14494] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14495 RXN-14495] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16148 RXN-16148] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16149 RXN-16149] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16153 RXN-16153] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16154 RXN-16154] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16155 RXN-16155] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16156 RXN-16156] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=hydroxylated fatty acid biosynthesis (plants)}} | |
− | + | {{#set: reaction found=7}} | |
− | + | {{#set: total reaction=22}} | |
− | + | {{#set: completion rate=32.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:04, 21 March 2018
Pathway PWY-6433
- taxonomic range:
- common name:
- hydroxylated fatty acid biosynthesis (plants)
- Synonym(s):
Reaction(s) found
7 reactions found over 22 reactions in the full pathway
- RXN-13322
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-16150
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-16151
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-16152
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-16157
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-16158
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9670
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- RXN-14484
- RXN-14485
- RXN-14486
- RXN-14488
- RXN-14491
- RXN-14492
- RXN-14493
- RXN-14494
- RXN-14495
- RXN-16148
- RXN-16149
- RXN-16153
- RXN-16154
- RXN-16155
- RXN-16156