Difference between revisions of "CPD-8607"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=POLYPEPTIDE POLYPEPTIDE] == * common name: ** a polypeptide * Synonym(s): == Reaction(s) known...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=POLYPEPTIDE POLYPEPTIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
 +
* smiles:
 +
** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
 +
* inchi key:
 +
** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
 
* common name:
 
* common name:
** a polypeptide
+
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
 +
* molecular weight:
 +
** 444.74   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.11.2-RXN]]
+
* [[RXN66-12]]
* [[3.4.14.5-RXN]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.11.2-RXN]]
+
* [[RXN66-11]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a polypeptide}}
+
* PUBCHEM:
{{#set: consumed by=3.4.11.2-RXN|3.4.14.5-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201302 25201302]
{{#set: produced by=3.4.11.2-RXN}}
+
* HMDB : HMDB12160
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
 +
{{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}}
 +
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: molecular weight=444.74    }}
 +
{{#set: consumed by=RXN66-12}}
 +
{{#set: produced by=RXN66-11}}

Latest revision as of 19:05, 21 March 2018

Metabolite CPD-8607

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
  • common name:
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
  • molecular weight:
    • 444.74
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.