Difference between revisions of "PWY-5338"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] == * smiles: ** CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5338 PWY-5338] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5338 PWY-5338] ==
* smiles:
+
* taxonomic range:
** CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]
* inchi key:
+
** InChIKey=ANKZYBDXHMZBDK-SCRDCRAPSA-K
+
 
* common name:
 
* common name:
** FMN
+
** galactosylcyclitol biosynthesis
* molecular weight:
+
** 453.324   
+
 
* Synonym(s):
 
* Synonym(s):
** flavin mononucleotide
 
** riboflavin 5'-phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-9510]]
+
'''1''' reactions found over '''4''' reactions in the full pathway
* [[FADSYN-RXN]]
+
* [[RXN-8281]]
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
* [[RIBOFLAVINKIN-RXN]]
+
*** [[Ec-10_001650]]
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8277 RXN-8277]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8278 RXN-8278]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8279 RXN-8279]
 
== External links  ==
 
== External links  ==
* CAS : 146-17-8
+
{{#set: taxonomic range=TAX-3803}}
* Wikipedia : Flavin_mononucleotide
+
{{#set: common name=galactosylcyclitol biosynthesis}}
* BIGG : 33703
+
{{#set: reaction found=1}}
* PUBCHEM:
+
{{#set: total reaction=4}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229199 44229199]
+
{{#set: completion rate=25.0}}
* HMDB : HMDB01520
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00061 C00061]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58210 58210]
+
* METABOLIGHTS : MTBLC58210
+
{{#set: smiles=CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3)))}}
+
{{#set: inchi key=InChIKey=ANKZYBDXHMZBDK-SCRDCRAPSA-K}}
+
{{#set: common name=FMN}}
+
{{#set: molecular weight=453.324    }}
+
{{#set: common name=flavin mononucleotide|riboflavin 5'-phosphate}}
+
{{#set: consumed by=RXN-9510|FADSYN-RXN}}
+
{{#set: produced by=RIBOFLAVINKIN-RXN}}
+

Latest revision as of 19:05, 21 March 2018

Pathway PWY-5338

  • taxonomic range:
  • common name:
    • galactosylcyclitol biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links