Difference between revisions of "L-CANALINE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_007560 == * left end position: ** 6738284 * transcription direction: ** NEGATIVE * right end position: ** 6747833 * centisome position: ** 80.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] == * smiles: ** C(CC([N+])C(=O)[O-])ON * inchi key: ** InChIKey=FQPGMQAB...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(CC([N+])C(=O)[O-])ON |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N |
| − | * | + | * common name: |
| − | ** | + | ** L-canaline |
| − | * | + | * molecular weight: |
| − | ** | + | ** 134.135 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-a-amino-g-(aminooxy)-n-butyric acid |
| − | ** | + | ** L-2-amino-4-(aminooxy)butyric acid |
| + | ** L-2-amino-4-(aminooxy)butyrate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-9]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-34]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 496-93-5 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246035 25246035] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08270 C08270] |
| − | {{#set: | + | * HMDB : HMDB12251 |
| − | {{#set: | + | {{#set: smiles=C(CC([N+])C(=O)[O-])ON}} |
| + | {{#set: inchi key=InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N}} | ||
| + | {{#set: common name=L-canaline}} | ||
| + | {{#set: molecular weight=134.135 }} | ||
| + | {{#set: common name=L-a-amino-g-(aminooxy)-n-butyric acid|L-2-amino-4-(aminooxy)butyric acid|L-2-amino-4-(aminooxy)butyrate}} | ||
| + | {{#set: consumed by=RXN-9}} | ||
| + | {{#set: produced by=RXN-34}} | ||
Latest revision as of 19:05, 21 March 2018
Contents
Metabolite L-CANALINE
- smiles:
- C(CC([N+])C(=O)[O-])ON
- inchi key:
- InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N
- common name:
- L-canaline
- molecular weight:
- 134.135
- Synonym(s):
- L-a-amino-g-(aminooxy)-n-butyric acid
- L-2-amino-4-(aminooxy)butyric acid
- L-2-amino-4-(aminooxy)butyrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])ON" cannot be used as a page name in this wiki.
