Difference between revisions of "Ec-24 002370"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] == * smiles: ** C(CC([N+])C(=O)[O-])ON * inchi key: ** InChIKey=FQPGMQAB...")
(Created page with "Category:Gene == Gene Ec-24_002370 == * left end position: ** 2697752 * transcription direction: ** POSITIVE * right end position: ** 2702402 * centisome position: ** 54.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] ==
+
== Gene Ec-24_002370 ==
−
* smiles:
+
* left end position:
−
** C(CC([N+])C(=O)[O-])ON
+
** 2697752
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** L-canaline
+
** 2702402
−
* molecular weight:
+
* centisome position:
−
** 134.135    
+
** 54.0884    
 
* Synonym(s):
 
* Synonym(s):
−
** L-a-amino-g-(aminooxy)-n-butyric acid
+
** Esi_0060_0110
−
** L-2-amino-4-(aminooxy)butyric acid
+
** Esi0060_0110
−
** L-2-amino-4-(aminooxy)butyrate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9]]
+
* Reaction: [[PEROXID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-34]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-11329]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17352]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* CAS : 496-93-5
+
{{#set: left end position=2697752}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246035 25246035]
+
{{#set: right end position=2702402}}
−
* LIGAND-CPD:
+
{{#set: centisome position=54.0884   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08270 C08270]
+
{{#set: common name=Esi_0060_0110|Esi0060_0110}}
−
* HMDB : HMDB12251
+
{{#set: reaction associated=PEROXID-RXN|RXN-11329|RXN-14240|RXN-15288|RXN-17352|RXN-8635}}
−
{{#set: smiles=C(CC([N+])C(=O)[O-])ON}}
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}}
−
{{#set: inchi key=InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N}}
+
−
{{#set: common name=L-canaline}}
+
−
{{#set: molecular weight=134.135   }}
+
−
{{#set: common name=L-a-amino-g-(aminooxy)-n-butyric acid|L-2-amino-4-(aminooxy)butyric acid|L-2-amino-4-(aminooxy)butyrate}}
+
−
{{#set: consumed by=RXN-9}}
+
−
{{#set: produced by=RXN-34}}
+

Latest revision as of 19:05, 21 March 2018

Gene Ec-24_002370

  • left end position:
    • 2697752
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2702402
  • centisome position:
    • 54.0884
  • Synonym(s):
    • Esi_0060_0110
    • Esi0060_0110

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_002370&oldid=24481"