Difference between revisions of "CPD-8678"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P341-PWY P341-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * smiles: ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=R...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO |
| + | * inchi key: | ||
| + | ** InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 9(S)-HPOTE |
| + | * molecular weight: | ||
| + | ** 309.425 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid |
| − | + | ** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate | |
| − | ** | + | |
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8497]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852426 49852426] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60962 60962] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16321 C16321] |
| + | {{#set: smiles=CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO}} | ||
| + | {{#set: inchi key=InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M}} | ||
| + | {{#set: common name=9(S)-HPOTE}} | ||
| + | {{#set: molecular weight=309.425 }} | ||
| + | {{#set: common name=9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid|9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate}} | ||
| + | {{#set: produced by=RXN-8497}} | ||
Latest revision as of 19:05, 21 March 2018
Contents
Metabolite CPD-8678
- smiles:
- CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO
- inchi key:
- InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M
- common name:
- 9(S)-HPOTE
- molecular weight:
- 309.425
- Synonym(s):
- 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
- 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO" cannot be used as a page name in this wiki.
