Difference between revisions of "3-SULFINYL-PYRUVATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(S([O-])=O)C(=O)C(=O)[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L |
* common name: | * common name: | ||
− | ** 3- | + | ** 3-sulfinopyruvate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 150.106 |
* Synonym(s): | * Synonym(s): | ||
− | ** 3- | + | ** 3-sulphinyl-pyruvate |
+ | ** β-sulfinylpyruvate | ||
+ | ** 3-sulfinyl-pyruvate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
== External links == | == External links == | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05527 C05527] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1665 1665] |
− | * | + | * METABOLIGHTS : MTBLC1665 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244536 25244536] |
− | * HMDB : | + | * HMDB : HMDB02332 |
− | {{#set: smiles= | + | {{#set: smiles=C(S([O-])=O)C(=O)C(=O)[O-]}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L}} |
− | {{#set: common name=3- | + | {{#set: common name=3-sulfinopyruvate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=150.106 }} |
− | {{#set: common name=3- | + | {{#set: common name=3-sulphinyl-pyruvate|β-sulfinylpyruvate|3-sulfinyl-pyruvate}} |
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=3-SULFINOALANINE-AMINOTRANSFERASE-RXN}} |
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite 3-SULFINYL-PYRUVATE
- smiles:
- C(S([O-])=O)C(=O)C(=O)[O-]
- inchi key:
- InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L
- common name:
- 3-sulfinopyruvate
- molecular weight:
- 150.106
- Synonym(s):
- 3-sulphinyl-pyruvate
- β-sulfinylpyruvate
- 3-sulfinyl-pyruvate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(S([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.