Difference between revisions of "Ec-12 004670"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...") |
(Created page with "Category:Gene == Gene Ec-12_004670 == * left end position: ** 4353110 * transcription direction: ** POSITIVE * right end position: ** 4355020 * centisome position: ** 52.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_004670 == |
− | * | + | * left end position: |
− | ** | + | ** 4353110 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4355020 |
− | * | + | * centisome position: |
− | ** | + | ** 52.220284 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0070_0047 |
− | ** | + | ** Esi0070_0047 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[RXN-15043]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16025]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16032]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16066]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16067]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16076]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16077]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16118]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-1623]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17008]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17009]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17010]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17011]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17012]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17013]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17014]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17015]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17019]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17020]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17021]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17022]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17023]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17024]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17729]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN0-5514]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN0-6705]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[TRIGLSYN-PWY]] | ||
+ | * [[PWY-7411]] | ||
+ | * [[PWY-7589]] | ||
+ | * [[PWY-7782]] | ||
+ | * [[PWY-5667]] | ||
+ | * [[PWY-5981]] | ||
+ | * [[PWY-7417]] | ||
+ | * [[PWY0-1319]] | ||
+ | * [[PWY-7587]] | ||
+ | * [[PWY-6453]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4353110}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=4355020}} |
− | {{#set: | + | {{#set: centisome position=52.220284 }} |
− | {{#set: | + | {{#set: common name=Esi_0070_0047|Esi0070_0047}} |
− | {{#set: | + | {{#set: reaction associated=1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN|RXN-15043|RXN-16025|RXN-16032|RXN-16066|RXN-16067|RXN-16076|RXN-16077|RXN-16118|RXN-1623|RXN-17008|RXN-17009|RXN-17010|RXN-17011|RXN-17012|RXN-17013|RXN-17014|RXN-17015|RXN-17019|RXN-17020|RXN-17021|RXN-17022|RXN-17023|RXN-17024|RXN-17729|RXN0-5514|RXN0-6705}} |
− | {{#set: common name= | + | {{#set: pathway associated=TRIGLSYN-PWY|PWY-7411|PWY-7589|PWY-7782|PWY-5667|PWY-5981|PWY-7417|PWY0-1319|PWY-7587|PWY-6453}} |
− | {{#set: | + |
Latest revision as of 19:06, 21 March 2018
Gene Ec-12_004670
- left end position:
- 4353110
- transcription direction:
- POSITIVE
- right end position:
- 4355020
- centisome position:
- 52.220284
- Synonym(s):
- Esi_0070_0047
- Esi0070_0047
Reactions associated
- Reaction: 1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15043
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16025
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16032
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16066
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16067
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16076
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16077
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16118
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-1623
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17008
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17009
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17010
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17011
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17012
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17013
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17014
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17015
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17019
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17020
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17021
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17022
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17023
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17024
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17729
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-5514
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-6705
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome