Difference between revisions of "Ec-07 003570"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)N...")
(Created page with "Category:Gene == Gene Ec-07_003570 == * left end position: ** 3642662 * transcription direction: ** NEGATIVE * right end position: ** 3649833 * centisome position: ** 47.1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] ==
+
== Gene Ec-07_003570 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3642662
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** trans-2,3-dehydroadipyl-coA
+
** 3649833
−
* molecular weight:
+
* centisome position:
−
** 888.606    
+
** 47.169895    
 
* Synonym(s):
 
* Synonym(s):
−
** cis-2,3-didehydroadipyl-CoA
+
** Esi_0046_0115
−
** 2,3-didehydroadipyl-CoA
+
** Esi0046_0115
 +
** PK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-2425]]
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3642662}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926262 46926262]
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679154 70679154]
+
{{#set: right end position=3649833}}
−
* CHEBI:
+
{{#set: centisome position=47.169895   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67261 67261]
+
{{#set: common name=Esi_0046_0115|Esi0046_0115|PK}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71044 71044]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C14144 C14144]
+
−
* HMDB : HMDB60392
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I}}
+
−
{{#set: common name=trans-2,3-dehydroadipyl-coA}}
+
−
{{#set: molecular weight=888.606   }}
+
−
{{#set: common name=cis-2,3-didehydroadipyl-CoA|2,3-didehydroadipyl-CoA}}
+
−
{{#set: reversible reaction associated=RXN-2425}}
+

Latest revision as of 19:06, 21 March 2018

Gene Ec-07_003570

  • left end position:
    • 3642662
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3649833
  • centisome position:
    • 47.169895
  • Synonym(s):
    • Esi_0046_0115
    • Esi0046_0115
    • PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_003570&oldid=24623"