Difference between revisions of "Ec-02 004080"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] == * smiles: ** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Ec-02_004080 == * left end position: ** 4395180 * transcription direction: ** NEGATIVE * right end position: ** 4407628 * centisome position: ** 67.3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] ==
+
== Gene Ec-02_004080 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4395180
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 7-hydroxylauroyl-CoA
+
** 4407628
−
* molecular weight:
+
* centisome position:
−
** 961.807    
+
** 67.330284    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-hydroxydodecanoyl-CoA
+
** Esi_0041_0152
 +
** Esi0041_0152
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.4.1.223-RXN]]
−
* [[RXN-12184]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-6558]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4395180}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819849 91819849]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=4407628}}
−
{{#set: inchi key=InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J}}
+
{{#set: centisome position=67.330284   }}
−
{{#set: common name=7-hydroxylauroyl-CoA}}
+
{{#set: common name=Esi_0041_0152|Esi0041_0152}}
−
{{#set: molecular weight=961.807   }}
+
{{#set: reaction associated=2.4.1.223-RXN}}
−
{{#set: common name=7-hydroxydodecanoyl-CoA}}
+
{{#set: pathway associated=PWY-6558}}
−
{{#set: produced by=RXN-12184}}
+

Latest revision as of 19:07, 21 March 2018

Gene Ec-02_004080

  • left end position:
    • 4395180
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4407628
  • centisome position:
    • 67.330284
  • Synonym(s):
    • Esi_0041_0152
    • Esi0041_0152

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_004080&oldid=24628"