Difference between revisions of "CPD-11763"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TYRFUMCAT-PWY TYRFUMCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=TYRFUMCAT-PWY TYRFUMCAT-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
+
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
* inchi key:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
+
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
 
* common name:
 
* common name:
** L-tyrosine degradation I
+
** bisorganyltrisulfane
 +
* molecular weight:
 +
** 644.686   
 
* Synonym(s):
 
* Synonym(s):
** tyrosine fumarate catabolism
+
** GS3G
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** 1 associated gene(s):
+
* [[RXN-10851]]
*** [[Ec-23_003630]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[HOMOGENTISATE-12-DIOXYGENASE-RXN]]
+
** 1 associated gene(s):
+
*** [[Ec-17_003830]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=FUMARYLACETOACETASE-RXN FUMARYLACETOACETASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=MALEYLACETOACETATE-ISOMERASE-RXN MALEYLACETOACETATE-ISOMERASE-RXN]
+
 
== External links  ==
 
== External links  ==
* UM-BBD-PWY : tyr
+
* PUBCHEM:
{{#set: taxonomic range=TAX-1224}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
{{#set: taxonomic range=TAX-4751}}
+
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
{{#set: taxonomic range=TAX-40674}}
+
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
{{#set: common name=L-tyrosine degradation I}}
+
{{#set: common name=bisorganyltrisulfane}}
{{#set: common name=tyrosine fumarate catabolism}}
+
{{#set: molecular weight=644.686    }}
{{#set: reaction found=3}}
+
{{#set: common name=GS3G}}
{{#set: total reaction=5}}
+
{{#set: reversible reaction associated=RXN-10851}}
{{#set: completion rate=60.0}}
+

Latest revision as of 19:07, 21 March 2018

Metabolite CPD-11763

  • smiles:
    • C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
  • inchi key:
    • InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
  • common name:
    • bisorganyltrisulfane
  • molecular weight:
    • 644.686
  • Synonym(s):
    • GS3G

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.