Difference between revisions of "Ec-03 001180"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
(Created page with "Category:Gene == Gene Ec-03_001180 == * left end position: ** 1432296 * transcription direction: ** NEGATIVE * right end position: ** 1454287 * centisome position: ** 21.9...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
+
== Gene Ec-03_001180 ==
−
* smiles:
+
* left end position:
−
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
+
** 1432296
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** bisorganyltrisulfane
+
** 1454287
−
* molecular weight:
+
* centisome position:
−
** 644.686    
+
** 21.938587    
 
* Synonym(s):
 
* Synonym(s):
−
** GS3G
+
** Esi_0224_0006
 +
** Esi0224_0006
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-10851]]
+
*** Assignment: go-term
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7210]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7184]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1432296}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
+
{{#set: right end position=1454287}}
−
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
+
{{#set: centisome position=21.938587   }}
−
{{#set: common name=bisorganyltrisulfane}}
+
{{#set: common name=Esi_0224_0006|Esi0224_0006}}
−
{{#set: molecular weight=644.686   }}
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
{{#set: common name=GS3G}}
+
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-6545|PWY-7184}}
−
{{#set: reversible reaction associated=RXN-10851}}
+

Latest revision as of 19:07, 21 March 2018

Gene Ec-03_001180

  • left end position:
    • 1432296
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1454287
  • centisome position:
    • 21.938587
  • Synonym(s):
    • Esi_0224_0006
    • Esi0224_0006

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_001180&oldid=24690"