Difference between revisions of "CPD-15365"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-3-beta-D-Glucans 1-3-beta-D-Glucans] == * common name: ** a 1,3-β-D-glucan * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == |
+ | * smiles: | ||
+ | ** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** densipoloyl-CoA |
+ | * molecular weight: | ||
+ | ** 1041.936 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-16150]] |
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658551 90658551] |
− | {{#set: | + | {{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J}} |
− | {{#set: reversible reaction associated= | + | {{#set: common name=densipoloyl-CoA}} |
+ | {{#set: molecular weight=1041.936 }} | ||
+ | {{#set: reversible reaction associated=RXN-16150}} |
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite CPD-15365
- smiles:
- CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J
- common name:
- densipoloyl-CoA
- molecular weight:
- 1041.936
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.