Difference between revisions of "Ec-16 001760"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Gene == Gene Ec-16_001760 == * left end position: ** 2040942 * transcription direction: ** NEGATIVE * right end position: ** 2048654 * centisome position: ** 38.2...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] ==
+
== Gene Ec-16_001760 ==
−
* smiles:
+
* left end position:
−
** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2040942
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** densipoloyl-CoA
+
** 2048654
−
* molecular weight:
+
* centisome position:
−
** 1041.936    
+
** 38.236687    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0047_0106
 +
** Esi0047_0106
 +
** HDH
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[HISTALDEHYD-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16150]]
+
*** Assignment: ec-number
 +
* Reaction: [[HISTOLDEHYD-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-8001]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[HISTSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2040942}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658551 90658551]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=2048654}}
−
{{#set: inchi key=InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J}}
+
{{#set: centisome position=38.236687    }}
−
{{#set: common name=densipoloyl-CoA}}
+
{{#set: common name=Esi_0047_0106|Esi0047_0106|HDH}}
−
{{#set: molecular weight=1041.936    }}
+
{{#set: reaction associated=HISTALDEHYD-RXN|HISTOLDEHYD-RXN|RXN-8001}}
−
{{#set: reversible reaction associated=RXN-16150}}
+
{{#set: pathway associated=HISTSYN-PWY}}

Latest revision as of 19:08, 21 March 2018

Gene Ec-16_001760

  • left end position:
    • 2040942
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2048654
  • centisome position:
    • 38.236687
  • Synonym(s):
    • Esi_0047_0106
    • Esi0047_0106
    • HDH

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_001760&oldid=24777"