Difference between revisions of "Ec-18 004550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5175 PWY-5175] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5175 PWY-5175] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
−
* inchi key:
+
−
** InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N
+
 
* common name:
 
* common name:
−
** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
+
** lactucaxanthin biosynthesis
−
* molecular weight:
+
−
** 697.095   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
−
* [[RXN-14177]]
+
* [[RXN-8028]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-02_005510]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8029 RXN-8029]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8030 RXN-8030]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-3398}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05814 C05814]
+
{{#set: common name=lactucaxanthin biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28636 28636]
+
{{#set: total reaction=3}}
−
* PUBCHEM:
+
{{#set: completion rate=33.0}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280836 5280836]
+
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)}}
+
−
{{#set: inchi key=InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N}}
+
−
{{#set: common name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}}
+
−
{{#set: molecular weight=697.095    }}
+
−
{{#set: produced by=RXN-14177}}
+

Revision as of 20:47, 17 March 2018

Pathway PWY-5175

  • taxonomic range:
  • common name:
    • lactucaxanthin biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_004550&oldid=10330"