Difference between revisions of "Ec-05 000950"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
(Created page with "Category:Gene == Gene Ec-05_000950 == * left end position: ** 2071506 * transcription direction: ** POSITIVE * right end position: ** 2084568 * centisome position: ** 22.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_000950 == |
− | * | + | * left end position: |
− | ** | + | ** 2071506 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2084568 |
− | * | + | * centisome position: |
− | ** | + | ** 22.755041 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0169_0029 |
− | ** | + | ** Esi0169_0029 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[5-NUCLEOTID-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | * Reaction: [[AMP-DEPHOSPHORYLATION-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN-14025]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN-14026]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-14227]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-5841]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-7607]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-7609]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[XMPXAN-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5381]] | ||
+ | * [[PWY-6607]] | ||
+ | * [[PWY-7185]] | ||
+ | * [[SALVADEHYPOX-PWY]] | ||
+ | * [[PWY-6596]] | ||
+ | * [[NAD-BIOSYNTHESIS-II]] | ||
+ | * [[PWY-6606]] | ||
+ | * [[PWY-6608]] | ||
+ | * [[PWY-5695]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2071506}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2084568}} | |
− | + | {{#set: centisome position=22.755041 }} | |
− | + | {{#set: common name=Esi_0169_0029|Esi0169_0029}} | |
− | + | {{#set: reaction associated=5-NUCLEOTID-RXN|AMP-DEPHOSPHORYLATION-RXN|RXN-14025|RXN-14026|RXN-14227|RXN-5841|RXN-7607|RXN-7609|XMPXAN-RXN}} | |
− | + | {{#set: pathway associated=PWY-5381|PWY-6607|PWY-7185|SALVADEHYPOX-PWY|PWY-6596|NAD-BIOSYNTHESIS-II|PWY-6606|PWY-6608|PWY-5695}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name=5 | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 20:10, 21 March 2018
Gene Ec-05_000950
- left end position:
- 2071506
- transcription direction:
- POSITIVE
- right end position:
- 2084568
- centisome position:
- 22.755041
- Synonym(s):
- Esi_0169_0029
- Esi0169_0029
Reactions associated
- Reaction: 5-NUCLEOTID-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: AMP-DEPHOSPHORYLATION-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14025
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14026
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14227
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-5841
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-7607
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-7609
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: XMPXAN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome