Difference between revisions of "Ec-03 000770"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...")
(Created page with "Category:Gene == Gene Ec-03_000770 == * Synonym(s): ** Esi_0027_0032 ** Esi0027_0032 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
+
== Gene Ec-03_000770 ==
−
* smiles:
+
−
** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)([O-])[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
−
* inchi key:
+
−
** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
+
−
* common name:
+
−
** ppGpp
+
−
* molecular weight:
+
−
** 598.123   
+
 
* Synonym(s):
 
* Synonym(s):
−
** guanosine tetraphosphate
+
** Esi_0027_0032
−
** guanosine 5'-diphosphate,3'-diphosphate
+
** Esi0027_0032
−
** guanosine 3',5'-bispyrophosphate
+
−
** guanosine 3',5'-bis(diphosphate)
+
−
** guanosine 3'-diphosphate 5'-diphosphate
+
−
** magic spot
+
−
** guanosine-5',3'-tetraphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
−
* [[GDPPYPHOSKIN-RXN]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB04022
+
{{#set: common name=Esi_0027_0032|Esi0027_0032}}
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-8443}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967]
+
{{#set: pathway associated=PWY-5381}}
−
* HMDB : HMDB59638
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828]
+
−
* BIGG : 37137
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)([O-])[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}}
+
−
{{#set: common name=ppGpp}}
+
−
{{#set: molecular weight=598.123    }}
+
−
{{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}}
+
−
{{#set: produced by=GDPPYPHOSKIN-RXN}}
+

Latest revision as of 20:10, 21 March 2018

Gene Ec-03_000770

  • Synonym(s):
    • Esi_0027_0032
    • Esi0027_0032

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_000770&oldid=25009"