Difference between revisions of "CPD0-1083"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10038 RXN-10038] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.7...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)O * inchi key: ** InChIKey=RGH...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10038 RXN-10038] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C(C(C(C(C([O-])=O)O)O)O)O)O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.1.164 EC-2.7.1.164]
+
** InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
 +
* common name:
 +
** aldehydo-L-galactonate
 +
* molecular weight:
 +
** 195.149   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[L-seryl-SEC-tRNAs]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[O-phospho-L-seryl-tRNASecs]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-11152]]
−
** 1 ATP[c] '''+''' 1 an L-seryl-[tRNAsec][c] '''<=>''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 an O-phospho-L-seryl-[tRNASec][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6281]], L-selenocysteine biosynthesis II (archaea and eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6281 PWY-6281]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08223 R08223]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229140 44229140]
−
{{#set: direction=REVERSIBLE}}
+
* CHEBI:
−
{{#set: ec number=EC-2.7.1.164}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53071 53071]
−
{{#set: in pathway=PWY-6281}}
+
* BIGG : 3138483
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://www.genome.jp/dbget-bin/www_bget?c15930 c15930]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)O}}
 +
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M}}
 +
{{#set: common name=aldehydo-L-galactonate}}
 +
{{#set: molecular weight=195.149    }}
 +
{{#set: reversible reaction associated=RXN-11152}}

Latest revision as of 19:10, 21 March 2018

Metabolite CPD0-1083

  • smiles:
    • C(C(C(C(C(C([O-])=O)O)O)O)O)O
  • inchi key:
    • InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
  • common name:
    • aldehydo-L-galactonate
  • molecular weight:
    • 195.149
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(C(C(C([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-1083&oldid=25011"