Difference between revisions of "CPD-7616"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200783 TAX-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200783 TAX-200783]
+
** C(C1(C=C(C(=CC=1)O)O))=O
 +
* inchi key:
 +
** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** reductive TCA cycle II
+
** protocatechualdehyde
 +
* molecular weight:
 +
** 138.123   
 
* Synonym(s):
 
* Synonym(s):
−
** reductive tricarboxylic acid cycle
+
** 3,4-dihydroxybenzaldehyde
−
** reductive tricarboxylic acid pathway
+
** 3,4-dihydroxybenzyl aldehyde
−
** reductive citric acid cycle
+
** rancinamycin IV
−
** reverse citric acid cycle
+
−
** carbon fixation
+
−
** CO2 fixation
+
−
** reductive carboxylic acid cycle
+
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''6''' reactions found over '''12''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[ACONITATEDEHYDR-RXN]]
+
* [[RXN-8872]]
−
** 2 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-16_001000]]
+
−
*** [[Ec-12_000170]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[ACONITATEHYDR-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Ec-16_001000]]
+
−
*** [[Ec-12_000170]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[FUMHYDR-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Ec-25_001360]]
+
−
*** [[Ec-23_003460]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[MALATE-DEH-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Ec-10_006200]]
+
−
*** [[Ec-02_003100]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[PYRUFLAVREDUCT-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-18_003420]]
+
−
*** [[Ec-15_004230]]
+
−
*** [[Ec-23_002710]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[SUCCCOASYN-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Ec-10_000030]]
+
−
*** [[Ec-02_001020]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=CITRATE--COA-LIGASE-RXN CITRATE--COA-LIGASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=R23-RXN R23-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7929 RXN-7929]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8457 RXN-8457]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-200783}}
+
* PUBCHEM:
−
{{#set: common name=reductive TCA cycle II}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768]
−
{{#set: common name=reductive tricarboxylic acid cycle|reductive tricarboxylic acid pathway|reductive citric acid cycle|reverse citric acid cycle|carbon fixation|CO2 fixation|reductive carboxylic acid cycle}}
+
* CHEMSPIDER:
−
{{#set: reaction found=6}}
+
** [http://www.chemspider.com/Chemical-Structure.8438.html 8438]
−
{{#set: total reaction=12}}
+
* CHEBI:
−
{{#set: completion rate=50.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700]
 +
* HMDB : HMDB59965
 +
{{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}}
 +
{{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}}
 +
{{#set: common name=protocatechualdehyde}}
 +
{{#set: molecular weight=138.123    }}
 +
{{#set: common name=3,4-dihydroxybenzaldehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}}
 +
{{#set: produced by=RXN-8872}}

Latest revision as of 19:10, 21 March 2018

Metabolite CPD-7616

  • smiles:
    • C(C1(C=C(C(=CC=1)O)O))=O
  • inchi key:
    • InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
  • common name:
    • protocatechualdehyde
  • molecular weight:
    • 138.123
  • Synonym(s):
    • 3,4-dihydroxybenzaldehyde
    • 3,4-dihydroxybenzyl aldehyde
    • rancinamycin IV

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7616&oldid=25028"